C31H26F9NO3 — CID 58897873
N-[(1E,3E,6R,7E,9E)-6-benzyl-3,10-difluoro-11-methoxy-5-methylidene-1-(1,1,2,2-tetrafluoroethoxy)dodeca-1,3,7,9,11-pentaen-6-yl]-3-(trifluoromethyl)benzamide (PubChem CID 58897873) has the molecular formula C31H26F9NO3 and a molecular weight of 631.54 g/mol. Its IUPAC name is N-[(1E,3E,6R,7E,9E)-6-benzyl-3,10-difluoro-11-methoxy-5-methylidene-1-(1,1,2,2-tetrafluoroethoxy)dodeca-1,3,7,9,11-pentaen-6-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(1E,3E,6R,7E,9E)-6-benzyl-3,10-difluoro-11-methoxy-5-methylidene-1-(1,1,2,2-tetrafluoroethoxy)dodeca-1,3,7,9,11-pentaen-6-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58897873 |
| Molecular Formula | C31H26F9NO3 |
| Molecular Weight | 631.54 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | N-[(1E,3E,6R,7E,9E)-6-benzyl-3,10-difluoro-11-methoxy-5-methylidene-1-(1,1,2,2-tetrafluoroethoxy)dodeca-1,3,7,9,11-pentaen-6-yl]-3-(trifluoromethyl)benzamide |
| SMILES | C=C(OC)/C(F)=C\C=C\[C@@](Cc1ccccc1)(NC(=O)c1cccc(C(F)(F)F)c1)C(=C)/C=C(F)\C=C\OC(F)(F)C(F)F |
| InChI | InChI=1S/C31H26F9NO3/c1-20(17-25(32)14-16-44-31(39,40)28(34)35)29(19-22-9-5-4-6-10-22,15-8-13-26(33)21(2)43-3)41-27(42)23-11-7-12-24(18-23)30(36,37)38/h4-18,28H,1-2,19H2,3H3,(H,41,42)/b15-8+,16-14+,25-17+,26-13+/t29-/m0/s1 |
| InChIKey | YUTXDVLIDAIYIT-ALGXRLHDSA-N |
| XLogP | 8.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.54 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|