C23H35NO2Si — CID 58900543
tert-butyl N-[[3-[tert-butyl(dimethyl)silyl]cyclopenta-1,4-dien-1-yl]-phenylmethyl]carbamate (PubChem CID 58900543) has the molecular formula C23H35NO2Si and a molecular weight of 385.62 g/mol. Its IUPAC name is tert-butyl N-[[3-[tert-butyl(dimethyl)silyl]cyclopenta-1,4-dien-1-yl]-phenylmethyl]carbamate.
| Compound Name | tert-butyl N-[[3-[tert-butyl(dimethyl)silyl]cyclopenta-1,4-dien-1-yl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 58900543 |
| Molecular Formula | C23H35NO2Si |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl N-[[3-[tert-butyl(dimethyl)silyl]cyclopenta-1,4-dien-1-yl]-phenylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC([Si](C)(C)C(C)(C)C)C=C1)c1ccccc1 |
| InChI | InChI=1S/C23H35NO2Si/c1-22(2,3)26-21(25)24-20(17-12-10-9-11-13-17)18-14-15-19(16-18)27(7,8)23(4,5)6/h9-16,19-20H,1-8H3,(H,24,25) |
| InChIKey | OYQALFYWSXVZBL-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|