C25H48O5Si — CID 58901360
[(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 58901360) has the molecular formula C25H48O5Si and a molecular weight of 456.74 g/mol. Its IUPAC name is [(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | [(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 58901360 |
| Molecular Formula | C25H48O5Si |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | [(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | C=CCOC(=O)[C@@H](OC(=O)C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C(C)C)C(C)C |
| InChI | InChI=1S/C25H48O5Si/c1-13-14-28-25(27)24(17(4)5)29-23(26)15-22(21(12)16(2)3)30-31(18(6)7,19(8)9)20(10)11/h13,16-22,24H,1,14-15H2,2-12H3/t21-,22+,24+/m1/s1 |
| InChIKey | RNXMURQDSCZJLU-GPXNEJASSA-N |
| XLogP | 6.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|