C17H30O4 — CID 123863633
[(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4R)-3,4,5-trimethylhexanoate (PubChem CID 123863633) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is [(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4R)-3,4,5-trimethylhexanoate.
| Compound Name | [(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4R)-3,4,5-trimethylhexanoate |
|---|---|
| PubChem CID | 123863633 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | [(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4R)-3,4,5-trimethylhexanoate |
| SMILES | C=CCOC(=O)[C@@H](OC(=O)C[C@H](C)[C@H](C)C(C)C)C(C)C |
| InChI | InChI=1S/C17H30O4/c1-8-9-20-17(19)16(12(4)5)21-15(18)10-13(6)14(7)11(2)3/h8,11-14,16H,1,9-10H2,2-7H3/t13-,14+,16-/m0/s1 |
| InChIKey | STLAJPSLNKCUNL-LZWOXQAQSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|