C10H12N2O2 — CID 58902797
(4-methylidenepiperidin-1-yl)-(1,2-oxazol-5-yl)methanone (PubChem CID 58902797) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (4-methylidenepiperidin-1-yl)-(1,2-oxazol-5-yl)methanone.
| Compound Name | (4-methylidenepiperidin-1-yl)-(1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 58902797 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (4-methylidenepiperidin-1-yl)-(1,2-oxazol-5-yl)methanone |
| SMILES | C=C1CCN(C(=O)c2ccno2)CC1 |
| InChI | InChI=1S/C10H12N2O2/c1-8-3-6-12(7-4-8)10(13)9-2-5-11-14-9/h2,5H,1,3-4,6-7H2 |
| InChIKey | XPPRMVFXGKRQIA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|