C27H29FO6S — CID 58903117
ethyl 3-[4-[[3-(2,6-dimethyl-4-methylsulfonyloxyphenyl)phenyl]methoxy]-2-fluorophenyl]propanoate (PubChem CID 58903117) has the molecular formula C27H29FO6S and a molecular weight of 500.59 g/mol. Its IUPAC name is ethyl 3-[4-[[3-(2,6-dimethyl-4-methylsulfonyloxyphenyl)phenyl]methoxy]-2-fluorophenyl]propanoate.
| Compound Name | ethyl 3-[4-[[3-(2,6-dimethyl-4-methylsulfonyloxyphenyl)phenyl]methoxy]-2-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 58903117 |
| Molecular Formula | C27H29FO6S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | ethyl 3-[4-[[3-(2,6-dimethyl-4-methylsulfonyloxyphenyl)phenyl]methoxy]-2-fluorophenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCc2cccc(-c3c(C)cc(OS(C)(=O)=O)cc3C)c2)cc1F |
| InChI | InChI=1S/C27H29FO6S/c1-5-32-26(29)12-10-21-9-11-23(16-25(21)28)33-17-20-7-6-8-22(15-20)27-18(2)13-24(14-19(27)3)34-35(4,30)31/h6-9,11,13-16H,5,10,12,17H2,1-4H3 |
| InChIKey | IAHGVCVLCPCMIS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|