C18H20N4O6 — CID 58905690
ethyl 3-[[6-(4-acetamidophenoxy)-3-nitro-2-pyridinyl]amino]propanoate (PubChem CID 58905690) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is ethyl 3-[[6-(4-acetamidophenoxy)-3-nitro-2-pyridinyl]amino]propanoate.
| Compound Name | ethyl 3-[[6-(4-acetamidophenoxy)-3-nitro-2-pyridinyl]amino]propanoate |
|---|---|
| PubChem CID | 58905690 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | ethyl 3-[[6-(4-acetamidophenoxy)-3-nitro-2-pyridinyl]amino]propanoate |
| SMILES | CCOC(=O)CCNc1nc(Oc2ccc(NC(C)=O)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N4O6/c1-3-27-17(24)10-11-19-18-15(22(25)26)8-9-16(21-18)28-14-6-4-13(5-7-14)20-12(2)23/h4-9H,3,10-11H2,1-2H3,(H,19,21)(H,20,23) |
| InChIKey | CLDGLNMTDVDUAB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|