C17H30OSi — CID 58907308
tert-butyl-dimethyl-[[(1S,2S,3S,6R,7R)-3-tricyclo[5.2.1.02,6]dec-8-enyl]methoxy]silane (PubChem CID 58907308) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,2S,3S,6R,7R)-3-tricyclo[5.2.1.02,6]dec-8-enyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,2S,3S,6R,7R)-3-tricyclo[5.2.1.02,6]dec-8-enyl]methoxy]silane |
|---|---|
| PubChem CID | 58907308 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,2S,3S,6R,7R)-3-tricyclo[5.2.1.02,6]dec-8-enyl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC[C@H]2[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C17H30OSi/c1-17(2,3)19(4,5)18-11-14-8-9-15-12-6-7-13(10-12)16(14)15/h6-7,12-16H,8-11H2,1-5H3/t12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | ZKFNEIZNTQIFCK-UYJHQMFVSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|