C13H24O6S — CID 58908275
5-methyl-1-(2-methylbutoxy)-1,4-dioxoheptane-2-sulfonic acid (PubChem CID 58908275) has the molecular formula C13H24O6S and a molecular weight of 308.40 g/mol. Its IUPAC name is 5-methyl-1-(2-methylbutoxy)-1,4-dioxoheptane-2-sulfonic acid.
| Compound Name | 5-methyl-1-(2-methylbutoxy)-1,4-dioxoheptane-2-sulfonic acid |
|---|---|
| PubChem CID | 58908275 |
| Molecular Formula | C13H24O6S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-methyl-1-(2-methylbutoxy)-1,4-dioxoheptane-2-sulfonic acid |
| SMILES | CCC(C)COC(=O)C(CC(=O)C(C)CC)S(=O)(=O)O |
| InChI | InChI=1S/C13H24O6S/c1-5-9(3)8-19-13(15)12(20(16,17)18)7-11(14)10(4)6-2/h9-10,12H,5-8H2,1-4H3,(H,16,17,18) |
| InChIKey | TUGREVVJVQNTEK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|