C14H18F2N2O4 — CID 58908879
benzyl N-(1-amino-5,5-difluoro-2-hydroxy-1-oxohexan-3-yl)carbamate (PubChem CID 58908879) has the molecular formula C14H18F2N2O4 and a molecular weight of 316.30 g/mol. Its IUPAC name is benzyl N-(1-amino-5,5-difluoro-2-hydroxy-1-oxohexan-3-yl)carbamate.
| Compound Name | benzyl N-(1-amino-5,5-difluoro-2-hydroxy-1-oxohexan-3-yl)carbamate |
|---|---|
| PubChem CID | 58908879 |
| Molecular Formula | C14H18F2N2O4 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | benzyl N-(1-amino-5,5-difluoro-2-hydroxy-1-oxohexan-3-yl)carbamate |
| SMILES | CC(F)(F)CC(NC(=O)OCc1ccccc1)C(O)C(N)=O |
| InChI | InChI=1S/C14H18F2N2O4/c1-14(15,16)7-10(11(19)12(17)20)18-13(21)22-8-9-5-3-2-4-6-9/h2-6,10-11,19H,7-8H2,1H3,(H2,17,20)(H,18,21) |
| InChIKey | PVKOHFOLGUCIAD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |