C20H29NOSi — CID 58911416
N-[[4-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]methyl]prop-2-en-1-amine (PubChem CID 58911416) has the molecular formula C20H29NOSi and a molecular weight of 327.54 g/mol. Its IUPAC name is N-[[4-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]methyl]prop-2-en-1-amine.
| Compound Name | N-[[4-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 58911416 |
| Molecular Formula | C20H29NOSi |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | N-[[4-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1ccc(O[Si](C)(C)C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C20H29NOSi/c1-7-14-21-15-16-12-13-19(18-11-9-8-10-17(16)18)22-23(5,6)20(2,3)4/h7-13,21H,1,14-15H2,2-6H3 |
| InChIKey | UAPBPSRAYCIVQB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|