C37H28IrN3O4 — CID 58914266
iridium(3+);bis(3-pyridin-2-ylbenzene-4-id-1-ol);(3-pyridin-2-ylbenzene-4-id-1-yl) 2-methylprop-2-enoate (PubChem CID 58914266) has the molecular formula C37H28IrN3O4 and a molecular weight of 770.87 g/mol. Its IUPAC name is iridium(3+);bis(3-pyridin-2-ylbenzene-4-id-1-ol);(3-pyridin-2-ylbenzene-4-id-1-yl) 2-methylprop-2-enoate.
| Compound Name | iridium(3+);bis(3-pyridin-2-ylbenzene-4-id-1-ol);(3-pyridin-2-ylbenzene-4-id-1-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58914266 |
| Molecular Formula | C37H28IrN3O4 |
| Molecular Weight | 770.87 g/mol |
| Exact Mass | 771.17 |
| IUPAC Name | iridium(3+);bis(3-pyridin-2-ylbenzene-4-id-1-ol);(3-pyridin-2-ylbenzene-4-id-1-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc[c-]c(-c2ccccn2)c1.Oc1cc[c-]c(-c2ccccn2)c1.Oc1cc[c-]c(-c2ccccn2)c1.[Ir+3] |
| InChI | InChI=1S/C15H12NO2.2C11H8NO.Ir/c1-11(2)15(17)18-13-7-5-6-12(10-13)14-8-3-4-9-16-14;2*13-10-5-3-4-9(8-10)11-6-1-2-7-12-11;/h3-5,7-10H,1H2,2H3;2*1-3,5-8,13H;/q3*-1;+3 |
| InChIKey | OOESFFNEDDFKLQ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 105.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.87 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|