C22H25N3O3S — CID 58919455
prop-2-enyl (3aS,9bS)-8-(dimethylcarbamoyl)-4-thiophen-3-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate (PubChem CID 58919455) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is prop-2-enyl (3aS,9bS)-8-(dimethylcarbamoyl)-4-thiophen-3-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate.
| Compound Name | prop-2-enyl (3aS,9bS)-8-(dimethylcarbamoyl)-4-thiophen-3-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 58919455 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | prop-2-enyl (3aS,9bS)-8-(dimethylcarbamoyl)-4-thiophen-3-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC[C@H]2C(c3ccsc3)Nc3ccc(C(=O)N(C)C)cc3[C@H]21 |
| InChI | InChI=1S/C22H25N3O3S/c1-4-10-28-22(27)25-9-7-16-19(15-8-11-29-13-15)23-18-6-5-14(21(26)24(2)3)12-17(18)20(16)25/h4-6,8,11-13,16,19-20,23H,1,7,9-10H2,2-3H3/t16-,19?,20-/m0/s1 |
| InChIKey | QHOSWCPDKWEGDB-LIXNJBPUSA-N |
| XLogP | 4.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|