C27H24ClF4N3O3 — CID 58921524
1-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethyl]-3-cyclopentylurea (PubChem CID 58921524) has the molecular formula C27H24ClF4N3O3 and a molecular weight of 549.95 g/mol. Its IUPAC name is 1-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethyl]-3-cyclopentylurea.
| Compound Name | 1-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethyl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 58921524 |
| Molecular Formula | C27H24ClF4N3O3 |
| Molecular Weight | 549.95 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 1-[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethyl]-3-cyclopentylurea |
| SMILES | O=C(NC1CCCC1)N[C@](Cc1ccccc1)(c1ccc2c(c1)OC(F)(F)C(F)(F)O2)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C27H24ClF4N3O3/c28-19-11-13-23(33-16-19)25(15-17-6-2-1-3-7-17,35-24(36)34-20-8-4-5-9-20)18-10-12-21-22(14-18)38-27(31,32)26(29,30)37-21/h1-3,6-7,10-14,16,20H,4-5,8-9,15H2,(H2,34,35,36)/t25-/m1/s1 |
| InChIKey | DLZCULHYYICHLF-RUZDIDTESA-N |
| XLogP | 6.42 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.95 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|