About [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate
[2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate (PubChem CID 58929322) has the molecular formula C16H16N6O3
and a molecular weight of 340.34 g/mol. Its IUPAC name is [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate |
| PubChem CID | 58929322 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc(-n2nnc(-c3ccccn3)n2)cc1OC |
| InChI | InChI=1S/C16H16N6O3/c1-3-17-16(23)25-13-8-7-11(10-14(13)24-2)22-20-15(19-21-22)12-6-4-5-9-18-12/h4-10H,3H2,1-2H3,(H,17,23) |
| InChIKey | XWSPJLKLKJPODS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate?
The IUPAC name of [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate (CID 58929322) is [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate.
What is the SMILES notation for [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate?
The canonical SMILES for [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate is CCNC(=O)Oc1ccc(-n2nnc(-c3ccccn3)n2)cc1OC.
What is the InChIKey of [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate?
The InChIKey is XWSPJLKLKJPODS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6O3/c1-3-17-16(23)25-13-8-7-11(10-14(13)24-2)22-20-15(19-21-22)12-6-4-5-9-18-12/h4-10H,3H2,1-2H3,(H,17,23).
What are the key properties of [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate?
[2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate has a molecular weight of 340.34 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-4-(5-pyridin-2-yltetrazol-2-yl)phenyl] N-ethylcarbamate is sourced from PubChem (CID 58929322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).