C23H21N3O3 — CID 58930472
N-(2-aminophenyl)-5-[(3-methoxyphenyl)methylamino]-1-benzofuran-2-carboxamide (PubChem CID 58930472) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[(3-methoxyphenyl)methylamino]-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[(3-methoxyphenyl)methylamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 58930472 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-(2-aminophenyl)-5-[(3-methoxyphenyl)methylamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc(CNc2ccc3oc(C(=O)Nc4ccccc4N)cc3c2)c1 |
| InChI | InChI=1S/C23H21N3O3/c1-28-18-6-4-5-15(11-18)14-25-17-9-10-21-16(12-17)13-22(29-21)23(27)26-20-8-3-2-7-19(20)24/h2-13,25H,14,24H2,1H3,(H,26,27) |
| InChIKey | MRCRCRDOJQLPLG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|