C21H25N3O4S2 — CID 58931471
N,N-diethyl-3-[6-methoxy-4-(5-nitrothiophen-2-yl)sulfanylquinolin-7-yl]oxypropan-1-amine (PubChem CID 58931471) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is N,N-diethyl-3-[6-methoxy-4-(5-nitrothiophen-2-yl)sulfanylquinolin-7-yl]oxypropan-1-amine.
| Compound Name | N,N-diethyl-3-[6-methoxy-4-(5-nitrothiophen-2-yl)sulfanylquinolin-7-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 58931471 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N,N-diethyl-3-[6-methoxy-4-(5-nitrothiophen-2-yl)sulfanylquinolin-7-yl]oxypropan-1-amine |
| SMILES | CCN(CC)CCCOc1cc2nccc(Sc3ccc([N+](=O)[O-])s3)c2cc1OC |
| InChI | InChI=1S/C21H25N3O4S2/c1-4-23(5-2)11-6-12-28-18-14-16-15(13-17(18)27-3)19(9-10-22-16)29-21-8-7-20(30-21)24(25)26/h7-10,13-14H,4-6,11-12H2,1-3H3 |
| InChIKey | WNXPBTOLVAEMEN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|