C15H24FNO4 — CID 58932163
1-O-tert-butyl 2-O-methyl (2S)-5-(2-fluoroethyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate (PubChem CID 58932163) has the molecular formula C15H24FNO4 and a molecular weight of 301.36 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-5-(2-fluoroethyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(2-fluoroethyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58932163 |
| Molecular Formula | C15H24FNO4 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(2-fluoroethyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC=C(CCF)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24FNO4/c1-15(2,3)21-14(19)17-10-8-11(7-9-16)5-6-12(17)13(18)20-4/h5,12H,6-10H2,1-4H3/t12-/m0/s1 |
| InChIKey | YRUOGHVNKJZATB-LBPRGKRZSA-N |
| XLogP | 2.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|