C16H25F2NO4 — CID 58667929
1-O-tert-butyl 2-O-methyl (2S)-5-(3,3-difluoropropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate (PubChem CID 58667929) has the molecular formula C16H25F2NO4 and a molecular weight of 333.38 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-5-(3,3-difluoropropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(3,3-difluoropropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58667929 |
| Molecular Formula | C16H25F2NO4 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(3,3-difluoropropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC=C(CCC(F)F)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25F2NO4/c1-16(2,3)23-15(21)19-10-9-11(6-8-13(17)18)5-7-12(19)14(20)22-4/h5,12-13H,6-10H2,1-4H3/t12-/m0/s1 |
| InChIKey | UQRDLQWSBNBSPY-LBPRGKRZSA-N |
| XLogP | 3.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|