C28H22N4O3 — CID 58933225
4-(7-methyl-1,3-dioxo-3a,4-dihydroisoindol-2-yl)-N-(4-phenyldiazenylphenyl)benzamide (PubChem CID 58933225) has the molecular formula C28H22N4O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is 4-(7-methyl-1,3-dioxo-3a,4-dihydroisoindol-2-yl)-N-(4-phenyldiazenylphenyl)benzamide.
| Compound Name | 4-(7-methyl-1,3-dioxo-3a,4-dihydroisoindol-2-yl)-N-(4-phenyldiazenylphenyl)benzamide |
|---|---|
| PubChem CID | 58933225 |
| Molecular Formula | C28H22N4O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-(7-methyl-1,3-dioxo-3a,4-dihydroisoindol-2-yl)-N-(4-phenyldiazenylphenyl)benzamide |
| SMILES | CC1=C2C(=O)N(c3ccc(C(=O)Nc4ccc(/N=N/c5ccccc5)cc4)cc3)C(=O)C2CC=C1 |
| InChI | InChI=1S/C28H22N4O3/c1-18-6-5-9-24-25(18)28(35)32(27(24)34)23-16-10-19(11-17-23)26(33)29-20-12-14-22(15-13-20)31-30-21-7-3-2-4-8-21/h2-8,10-17,24H,9H2,1H3,(H,29,33)/b31-30+ |
| InChIKey | IEORIKBRNKLSPX-NVQSTNCTSA-N |
| XLogP | 6.12 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|