C22H22F3N3O2 — CID 58933843
N-[[1-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropanecarbonyl]piperidin-4-yl]methyl]-2-fluoropyridine-4-carboxamide (PubChem CID 58933843) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is N-[[1-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropanecarbonyl]piperidin-4-yl]methyl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[[1-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropanecarbonyl]piperidin-4-yl]methyl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 58933843 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[[1-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropanecarbonyl]piperidin-4-yl]methyl]-2-fluoropyridine-4-carboxamide |
| SMILES | O=C(NCC1CCN(C(=O)[C@@H]2C[C@H]2c2c(F)cccc2F)CC1)c1ccnc(F)c1 |
| InChI | InChI=1S/C22H22F3N3O2/c23-17-2-1-3-18(24)20(17)15-11-16(15)22(30)28-8-5-13(6-9-28)12-27-21(29)14-4-7-26-19(25)10-14/h1-4,7,10,13,15-16H,5-6,8-9,11-12H2,(H,27,29)/t15-,16-/m1/s1 |
| InChIKey | MWEHLVNHGRBTTI-HZPDHXFCSA-N |
| XLogP | 3.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|