C26H18BrN3O4 — CID 58936615
7-bromo-3-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 58936615) has the molecular formula C26H18BrN3O4 and a molecular weight of 516.35 g/mol. Its IUPAC name is 7-bromo-3-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 7-bromo-3-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 58936615 |
| Molecular Formula | C26H18BrN3O4 |
| Molecular Weight | 516.35 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 7-bromo-3-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | COc1ccc2[nH]c3c(c4c(c5c6cc(Br)ccc6n([C@H]6C=C[C@@H](O)C6)c35)C(=O)NC4=O)c2c1 |
| InChI | InChI=1S/C26H18BrN3O4/c1-34-14-5-6-17-15(10-14)19-21-22(26(33)29-25(21)32)20-16-8-11(27)2-7-18(16)30(24(20)23(19)28-17)12-3-4-13(31)9-12/h2-8,10,12-13,28,31H,9H2,1H3,(H,29,32,33)/t12-,13+/m0/s1 |
| InChIKey | HRUOKAVFEFTNBS-QWHCGFSZSA-N |
| XLogP | 4.95 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|