C24H30N2O — CID 58938606
5-(2,4-dimethylphenyl)-1-heptan-3-yl-3-methylcinnolin-4-one (PubChem CID 58938606) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)-1-heptan-3-yl-3-methylcinnolin-4-one.
| Compound Name | 5-(2,4-dimethylphenyl)-1-heptan-3-yl-3-methylcinnolin-4-one |
|---|---|
| PubChem CID | 58938606 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 5-(2,4-dimethylphenyl)-1-heptan-3-yl-3-methylcinnolin-4-one |
| SMILES | CCCCC(CC)n1nc(C)c(=O)c2c(-c3ccc(C)cc3C)cccc21 |
| InChI | InChI=1S/C24H30N2O/c1-6-8-10-19(7-2)26-22-12-9-11-21(23(22)24(27)18(5)25-26)20-14-13-16(3)15-17(20)4/h9,11-15,19H,6-8,10H2,1-5H3 |
| InChIKey | DITQDTPZBWRGOH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |