C18H20N2O3P2 — CID 58940069
phosphanyliminophosphanyl (2R)-3-phenyl-2-(3-phenylpropanoylamino)propanoate (PubChem CID 58940069) has the molecular formula C18H20N2O3P2 and a molecular weight of 374.32 g/mol. Its IUPAC name is phosphanyliminophosphanyl (2R)-3-phenyl-2-(3-phenylpropanoylamino)propanoate.
| Compound Name | phosphanyliminophosphanyl (2R)-3-phenyl-2-(3-phenylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 58940069 |
| Molecular Formula | C18H20N2O3P2 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | phosphanyliminophosphanyl (2R)-3-phenyl-2-(3-phenylpropanoylamino)propanoate |
| SMILES | O=C(CCc1ccccc1)N[C@H](Cc1ccccc1)C(=O)O/P=N/P |
| InChI | InChI=1S/C18H20N2O3P2/c21-17(12-11-14-7-3-1-4-8-14)19-16(18(22)23-25-20-24)13-15-9-5-2-6-10-15/h1-10,16H,11-13,24H2,(H,19,21)/t16-/m1/s1 |
| InChIKey | LQGDJIVIJPIXQD-MRXNPFEDSA-N |
| XLogP | 3.72 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|