C69H44N4 — CID 58943557
2-[3-[7'-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 58943557) has the molecular formula C69H44N4 and a molecular weight of 929.14 g/mol. Its IUPAC name is 2-[3-[7'-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[7'-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58943557 |
| Molecular Formula | C69H44N4 |
| Molecular Weight | 929.14 g/mol |
| Exact Mass | 928.36 |
| IUPAC Name | 2-[3-[7'-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4ccc5c(c4)C4(c6ccccc6-c6ccccc64)c4cc(-c6cccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)c6)ccc4-5)c3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C69H44N4/c1-5-19-45(20-6-1)64-43-55(44-65(70-64)46-21-7-2-8-22-46)51-29-17-27-49(39-51)52-35-37-58-59-38-36-53(42-63(59)69(62(58)41-52)60-33-15-13-31-56(60)57-32-14-16-34-61(57)69)50-28-18-30-54(40-50)68-72-66(47-23-9-3-10-24-47)71-67(73-68)48-25-11-4-12-26-48/h1-44H |
| InChIKey | WAOAYMDDZUFMTD-UHFFFAOYSA-N |
| XLogP | 16.95 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.14 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |