C16H14N2O5 — CID 58944712
2-[[3-[(2-hydroxybenzoyl)amino]benzoyl]amino]acetic acid (PubChem CID 58944712) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-[[3-[(2-hydroxybenzoyl)amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[3-[(2-hydroxybenzoyl)amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 58944712 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[[3-[(2-hydroxybenzoyl)amino]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cccc(NC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C16H14N2O5/c19-13-7-2-1-6-12(13)16(23)18-11-5-3-4-10(8-11)15(22)17-9-14(20)21/h1-8,19H,9H2,(H,17,22)(H,18,23)(H,20,21) |
| InChIKey | KTBLFGIVRJMOBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |