C19H23FN6O3 — CID 58944894
(12S)-3-amino-7-fluoro-8-[3-[2-isocyano-1-(methylamino)ethyl]pyrrolidin-1-yl]-12-methyl-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione (PubChem CID 58944894) has the molecular formula C19H23FN6O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is (12S)-3-amino-7-fluoro-8-[3-[2-isocyano-1-(methylamino)ethyl]pyrrolidin-1-yl]-12-methyl-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione.
| Compound Name | (12S)-3-amino-7-fluoro-8-[3-[2-isocyano-1-(methylamino)ethyl]pyrrolidin-1-yl]-12-methyl-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
|---|---|
| PubChem CID | 58944894 |
| Molecular Formula | C19H23FN6O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (12S)-3-amino-7-fluoro-8-[3-[2-isocyano-1-(methylamino)ethyl]pyrrolidin-1-yl]-12-methyl-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
| SMILES | [C-]#[N+]CC(NC)C1CCN(c2c(F)cc3c(=O)n(N)c(=O)n4c3c2OC[C@@H]4C)C1 |
| InChI | InChI=1S/C19H23FN6O3/c1-10-9-29-17-15-12(18(27)26(21)19(28)25(10)15)6-13(20)16(17)24-5-4-11(8-24)14(23-3)7-22-2/h6,10-11,14,23H,4-5,7-9,21H2,1,3H3/t10-,11?,14?/m0/s1 |
| InChIKey | GNNGNHZKGWQGAU-IFQILLTASA-N |
| XLogP | 0.30 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|