C17H20FN3O5 — CID 59074190
8-[3-(1,2-dihydroxyethyl)pyrrolidin-1-yl]-7-fluoro-12-methyl-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione (PubChem CID 59074190) has the molecular formula C17H20FN3O5 and a molecular weight of 365.36 g/mol. Its IUPAC name is 8-[3-(1,2-dihydroxyethyl)pyrrolidin-1-yl]-7-fluoro-12-methyl-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione.
| Compound Name | 8-[3-(1,2-dihydroxyethyl)pyrrolidin-1-yl]-7-fluoro-12-methyl-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
|---|---|
| PubChem CID | 59074190 |
| Molecular Formula | C17H20FN3O5 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 8-[3-(1,2-dihydroxyethyl)pyrrolidin-1-yl]-7-fluoro-12-methyl-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
| SMILES | CC1COc2c(N3CCC(C(O)CO)C3)c(F)cc3c(=O)[nH]c(=O)n1c23 |
| InChI | InChI=1S/C17H20FN3O5/c1-8-7-26-15-13-10(16(24)19-17(25)21(8)13)4-11(18)14(15)20-3-2-9(5-20)12(23)6-22/h4,8-9,12,22-23H,2-3,5-7H2,1H3,(H,19,24,25) |
| InChIKey | ZOGBYXPFPGPCIA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |