C17H23N5O2 — CID 58945864
propan-2-yl 4-(5-methyl-1-phenyltriazol-4-yl)piperazine-1-carboxylate (PubChem CID 58945864) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is propan-2-yl 4-(5-methyl-1-phenyltriazol-4-yl)piperazine-1-carboxylate.
| Compound Name | propan-2-yl 4-(5-methyl-1-phenyltriazol-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58945864 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | propan-2-yl 4-(5-methyl-1-phenyltriazol-4-yl)piperazine-1-carboxylate |
| SMILES | Cc1c(N2CCN(C(=O)OC(C)C)CC2)nnn1-c1ccccc1 |
| InChI | InChI=1S/C17H23N5O2/c1-13(2)24-17(23)21-11-9-20(10-12-21)16-14(3)22(19-18-16)15-7-5-4-6-8-15/h4-8,13H,9-12H2,1-3H3 |
| InChIKey | IEJQOTLLCOHYFJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |