About propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride
propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride (PubChem CID 86696442) has the molecular formula C20H24ClN5O2
and a molecular weight of 401.90 g/mol. Its IUPAC name is propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride |
| PubChem CID | 86696442 |
| Molecular Formula | C20H24ClN5O2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride |
| SMILES | CC(C)OC(=O)N1CCN(c2ccc3ncc(-c4ccccc4)n3n2)CC1.Cl |
| InChI | InChI=1S/C20H23N5O2.ClH/c1-15(2)27-20(26)24-12-10-23(11-13-24)19-9-8-18-21-14-17(25(18)22-19)16-6-4-3-5-7-16;/h3-9,14-15H,10-13H2,1-2H3;1H |
| InChIKey | HSAZNNJMUVDQJY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride?
The IUPAC name of propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride (CID 86696442) is propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride.
What is the SMILES notation for propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride?
The canonical SMILES for propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride is CC(C)OC(=O)N1CCN(c2ccc3ncc(-c4ccccc4)n3n2)CC1.Cl.
What is the InChIKey of propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride?
The InChIKey is HSAZNNJMUVDQJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O2.ClH/c1-15(2)27-20(26)24-12-10-23(11-13-24)19-9-8-18-21-14-17(25(18)22-19)16-6-4-3-5-7-16;/h3-9,14-15H,10-13H2,1-2H3;1H.
What are the key properties of propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride?
propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride has a molecular weight of 401.90 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-(3-phenylimidazo[1,2-b]pyridazin-6-yl)piperazine-1-carboxylate;hydrochloride is sourced from PubChem (CID 86696442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).