C18H19ClFN3O2 — CID 141044300
1-chloroethyl 4-[5-(2-fluorophenyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 141044300) has the molecular formula C18H19ClFN3O2 and a molecular weight of 363.82 g/mol. Its IUPAC name is 1-chloroethyl 4-[5-(2-fluorophenyl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | 1-chloroethyl 4-[5-(2-fluorophenyl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141044300 |
| Molecular Formula | C18H19ClFN3O2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-chloroethyl 4-[5-(2-fluorophenyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(Cl)OC(=O)N1CCN(c2ccc(-c3ccccc3F)cn2)CC1 |
| InChI | InChI=1S/C18H19ClFN3O2/c1-13(19)25-18(24)23-10-8-22(9-11-23)17-7-6-14(12-21-17)15-4-2-3-5-16(15)20/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | HKONABMTLNVLKC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|