C19H22FN3O2 — CID 141044311
2-[4-[5-(2-fluorophenyl)-2-pyridinyl]piperazin-1-yl]ethyl acetate (PubChem CID 141044311) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-[4-[5-(2-fluorophenyl)-2-pyridinyl]piperazin-1-yl]ethyl acetate.
| Compound Name | 2-[4-[5-(2-fluorophenyl)-2-pyridinyl]piperazin-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 141044311 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-[4-[5-(2-fluorophenyl)-2-pyridinyl]piperazin-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCN1CCN(c2ccc(-c3ccccc3F)cn2)CC1 |
| InChI | InChI=1S/C19H22FN3O2/c1-15(24)25-13-12-22-8-10-23(11-9-22)19-7-6-16(14-21-19)17-4-2-3-5-18(17)20/h2-7,14H,8-13H2,1H3 |
| InChIKey | YZSDDUDHAGZWRK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |