C19H22F3N3O — CID 87767079
1-(2-methoxyethyl)-4-[5-(2,3,5-trifluoro-4-methylphenyl)-2-pyridinyl]piperazine (PubChem CID 87767079) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-[5-(2,3,5-trifluoro-4-methylphenyl)-2-pyridinyl]piperazine.
| Compound Name | 1-(2-methoxyethyl)-4-[5-(2,3,5-trifluoro-4-methylphenyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 87767079 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-(2-methoxyethyl)-4-[5-(2,3,5-trifluoro-4-methylphenyl)-2-pyridinyl]piperazine |
| SMILES | COCCN1CCN(c2ccc(-c3cc(F)c(C)c(F)c3F)cn2)CC1 |
| InChI | InChI=1S/C19H22F3N3O/c1-13-16(20)11-15(19(22)18(13)21)14-3-4-17(23-12-14)25-7-5-24(6-8-25)9-10-26-2/h3-4,11-12H,5-10H2,1-2H3 |
| InChIKey | LPXWMMMMSFVMDZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|