C24H26N4O2 — CID 58953883
N-[2-[4-(methylcarbamoyl)phenyl]-3H-benzimidazol-5-yl]bicyclo[2.2.2]octane-2-carboxamide (PubChem CID 58953883) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[2-[4-(methylcarbamoyl)phenyl]-3H-benzimidazol-5-yl]bicyclo[2.2.2]octane-2-carboxamide.
| Compound Name | N-[2-[4-(methylcarbamoyl)phenyl]-3H-benzimidazol-5-yl]bicyclo[2.2.2]octane-2-carboxamide |
|---|---|
| PubChem CID | 58953883 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[2-[4-(methylcarbamoyl)phenyl]-3H-benzimidazol-5-yl]bicyclo[2.2.2]octane-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2nc3ccc(NC(=O)C4CC5CCC4CC5)cc3[nH]2)cc1 |
| InChI | InChI=1S/C24H26N4O2/c1-25-23(29)17-8-6-16(7-9-17)22-27-20-11-10-18(13-21(20)28-22)26-24(30)19-12-14-2-4-15(19)5-3-14/h6-11,13-15,19H,2-5,12H2,1H3,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | QHPGKJKFLCUYOY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |