C30H28N6 — CID 58954246
2,4-bis(2-tert-butylbenzimidazol-1-yl)-5-isocyanobenzonitrile (PubChem CID 58954246) has the molecular formula C30H28N6 and a molecular weight of 472.60 g/mol. Its IUPAC name is 2,4-bis(2-tert-butylbenzimidazol-1-yl)-5-isocyanobenzonitrile.
| Compound Name | 2,4-bis(2-tert-butylbenzimidazol-1-yl)-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 58954246 |
| Molecular Formula | C30H28N6 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2,4-bis(2-tert-butylbenzimidazol-1-yl)-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c(-n2c(C(C)(C)C)nc3ccccc32)cc1-n1c(C(C)(C)C)nc2ccccc21 |
| InChI | InChI=1S/C30H28N6/c1-29(2,3)27-33-20-12-8-10-14-23(20)35(27)25-17-26(22(32-7)16-19(25)18-31)36-24-15-11-9-13-21(24)34-28(36)30(4,5)6/h8-17H,1-6H3 |
| InChIKey | WAMYDKGMICIADF-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 63.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|