C18H26O3 — CID 58954633
2-butyl-3-methoxy-5-methyl-6-[(E)-3-methylpent-2-enyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 58954633) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-butyl-3-methoxy-5-methyl-6-[(E)-3-methylpent-2-enyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-butyl-3-methoxy-5-methyl-6-[(E)-3-methylpent-2-enyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 58954633 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2-butyl-3-methoxy-5-methyl-6-[(E)-3-methylpent-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCC1=C(OC)C(=O)C(C)=C(C/C=C(\C)CC)C1=O |
| InChI | InChI=1S/C18H26O3/c1-6-8-9-15-17(20)14(11-10-12(3)7-2)13(4)16(19)18(15)21-5/h10H,6-9,11H2,1-5H3/b12-10+ |
| InChIKey | JHSJFQABGTXRDR-ZRDIBKRKSA-N |
| XLogP | 4.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|