C12H7BrN4O3S — CID 58957350
5-(4-bromothiophen-2-yl)-2,4,7-trioxo-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 58957350) has the molecular formula C12H7BrN4O3S and a molecular weight of 367.18 g/mol. Its IUPAC name is 5-(4-bromothiophen-2-yl)-2,4,7-trioxo-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 5-(4-bromothiophen-2-yl)-2,4,7-trioxo-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 58957350 |
| Molecular Formula | C12H7BrN4O3S |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | 5-(4-bromothiophen-2-yl)-2,4,7-trioxo-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | N#CC1C(=O)Nc2[nH]c(=O)[nH]c(=O)c2C1c1cc(Br)cs1 |
| InChI | InChI=1S/C12H7BrN4O3S/c13-4-1-6(21-3-4)7-5(2-14)10(18)15-9-8(7)11(19)17-12(20)16-9/h1,3,5,7H,(H3,15,16,17,18,19,20) |
| InChIKey | KCKLAJHNEKIHSG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |