C12H10Cl2N2O2 — CID 58958507
methyl 2-[(2,6-dichlorophenyl)methyl]-1H-imidazole-5-carboxylate (PubChem CID 58958507) has the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.13 g/mol. Its IUPAC name is methyl 2-[(2,6-dichlorophenyl)methyl]-1H-imidazole-5-carboxylate.
| Compound Name | methyl 2-[(2,6-dichlorophenyl)methyl]-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 58958507 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | methyl 2-[(2,6-dichlorophenyl)methyl]-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(Cc2c(Cl)cccc2Cl)[nH]1 |
| InChI | InChI=1S/C12H10Cl2N2O2/c1-18-12(17)10-6-15-11(16-10)5-7-8(13)3-2-4-9(7)14/h2-4,6H,5H2,1H3,(H,15,16) |
| InChIKey | TUZPBDIFPMZOAG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |