About 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine
1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine (PubChem CID 58959828) has the molecular formula C9H22N2O2S
and a molecular weight of 222.35 g/mol. Its IUPAC name is 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine |
| PubChem CID | 58959828 |
| Molecular Formula | C9H22N2O2S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine |
| SMILES | CCCS(O)(O)N1CCC(C)(N)CC1 |
| InChI | InChI=1S/C9H22N2O2S/c1-3-8-14(12,13)11-6-4-9(2,10)5-7-11/h12-13H,3-8,10H2,1-2H3 |
| InChIKey | LIZITMZDJCJRNU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine?
The IUPAC name of 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine (CID 58959828) is 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine.
What is the SMILES notation for 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine?
The canonical SMILES for 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine is CCCS(O)(O)N1CCC(C)(N)CC1.
What is the InChIKey of 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine?
The InChIKey is LIZITMZDJCJRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O2S/c1-3-8-14(12,13)11-6-4-9(2,10)5-7-11/h12-13H,3-8,10H2,1-2H3.
What are the key properties of 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine?
1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine has a molecular weight of 222.35 g/mol, XLogP of 1.88, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[dihydroxy(propyl)-λ4-sulfanyl]-4-methylpiperidin-4-amine is sourced from PubChem (CID 58959828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).