C8H15N3O2S — CID 172882114
6-propylsulfonyl-1,2,6-triazaspiro[2.5]oct-1-ene (PubChem CID 172882114) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 6-propylsulfonyl-1,2,6-triazaspiro[2.5]oct-1-ene.
| Compound Name | 6-propylsulfonyl-1,2,6-triazaspiro[2.5]oct-1-ene |
|---|---|
| PubChem CID | 172882114 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 6-propylsulfonyl-1,2,6-triazaspiro[2.5]oct-1-ene |
| SMILES | CCCS(=O)(=O)N1CCC2(CC1)N=N2 |
| InChI | InChI=1S/C8H15N3O2S/c1-2-7-14(12,13)11-5-3-8(4-6-11)9-10-8/h2-7H2,1H3 |
| InChIKey | LQPKTDFQGKRXOH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |