C13H23NO6S — CID 171358622
3-cyclopropyl-3-methyl-9-propylsulfonyl-1,2,4,5-tetraoxa-9-azaspiro[5.5]undecane (PubChem CID 171358622) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-cyclopropyl-3-methyl-9-propylsulfonyl-1,2,4,5-tetraoxa-9-azaspiro[5.5]undecane.
| Compound Name | 3-cyclopropyl-3-methyl-9-propylsulfonyl-1,2,4,5-tetraoxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 171358622 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-cyclopropyl-3-methyl-9-propylsulfonyl-1,2,4,5-tetraoxa-9-azaspiro[5.5]undecane |
| SMILES | CCCS(=O)(=O)N1CCC2(CC1)OOC(C)(C1CC1)OO2 |
| InChI | InChI=1S/C13H23NO6S/c1-3-10-21(15,16)14-8-6-13(7-9-14)19-17-12(2,18-20-13)11-4-5-11/h11H,3-10H2,1-2H3 |
| InChIKey | OULQILUCXZRQCL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|