C22H43NO2 — CID 58962261
N-[(3S,4R,5R)-1-[(5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]-4,5-dimethylheptan-3-yl]propanamide (PubChem CID 58962261) has the molecular formula C22H43NO2 and a molecular weight of 353.59 g/mol. Its IUPAC name is N-[(3S,4R,5R)-1-[(5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]-4,5-dimethylheptan-3-yl]propanamide.
| Compound Name | N-[(3S,4R,5R)-1-[(5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]-4,5-dimethylheptan-3-yl]propanamide |
|---|---|
| PubChem CID | 58962261 |
| Molecular Formula | C22H43NO2 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.33 |
| IUPAC Name | N-[(3S,4R,5R)-1-[(5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]-4,5-dimethylheptan-3-yl]propanamide |
| SMILES | CCC(=O)N[C@@H](CCC1OC(CC)[C@H](C)C(C)C1C)[C@H](C)[C@H](C)CC |
| InChI | InChI=1S/C22H43NO2/c1-9-14(4)15(5)19(23-22(24)11-3)12-13-21-18(8)16(6)17(7)20(10-2)25-21/h14-21H,9-13H2,1-8H3,(H,23,24)/t14-,15-,16?,17-,18?,19+,20?,21?/m1/s1 |
| InChIKey | CWBWGAHCXHVWFJ-NTZJGEEPSA-N |
| XLogP | 5.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |