C21H16ClN3O5S2 — CID 58962427
2-[4-chloro-2-(4-isocyanothiophene-2-carbonyl)phenoxy]-N-(2-methyl-4-sulfamoylphenyl)acetamide (PubChem CID 58962427) has the molecular formula C21H16ClN3O5S2 and a molecular weight of 489.96 g/mol. Its IUPAC name is 2-[4-chloro-2-(4-isocyanothiophene-2-carbonyl)phenoxy]-N-(2-methyl-4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-(4-isocyanothiophene-2-carbonyl)phenoxy]-N-(2-methyl-4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 58962427 |
| Molecular Formula | C21H16ClN3O5S2 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 2-[4-chloro-2-(4-isocyanothiophene-2-carbonyl)phenoxy]-N-(2-methyl-4-sulfamoylphenyl)acetamide |
| SMILES | [C-]#[N+]c1csc(C(=O)c2cc(Cl)ccc2OCC(=O)Nc2ccc(S(N)(=O)=O)cc2C)c1 |
| InChI | InChI=1S/C21H16ClN3O5S2/c1-12-7-15(32(23,28)29)4-5-17(12)25-20(26)10-30-18-6-3-13(22)8-16(18)21(27)19-9-14(24-2)11-31-19/h3-9,11H,10H2,1H3,(H,25,26)(H2,23,28,29) |
| InChIKey | MEZQCPRNYWRJFZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|