C15H12F3N5OS — CID 58964591
2-[(5-cyano-2-methylsulfanylpyrimidin-4-yl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 58964591) has the molecular formula C15H12F3N5OS and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-[(5-cyano-2-methylsulfanylpyrimidin-4-yl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(5-cyano-2-methylsulfanylpyrimidin-4-yl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 58964591 |
| Molecular Formula | C15H12F3N5OS |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-[(5-cyano-2-methylsulfanylpyrimidin-4-yl)amino]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CSc1ncc(C#N)c(NCC(=O)Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H12F3N5OS/c1-25-14-21-7-9(6-19)13(23-14)20-8-12(24)22-11-4-2-3-10(5-11)15(16,17)18/h2-5,7H,8H2,1H3,(H,22,24)(H,20,21,23) |
| InChIKey | INCGNBRMQCFQGI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |