C38H43N5O9 — CID 58965072
4-[4-[1-[[1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]isoquinolin-6-yl]amino]-2-[(3-nitrophenyl)methylamino]-2-oxoethyl]phenyl]butanoic acid (PubChem CID 58965072) has the molecular formula C38H43N5O9 and a molecular weight of 713.79 g/mol. Its IUPAC name is 4-[4-[1-[[1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]isoquinolin-6-yl]amino]-2-[(3-nitrophenyl)methylamino]-2-oxoethyl]phenyl]butanoic acid.
| Compound Name | 4-[4-[1-[[1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]isoquinolin-6-yl]amino]-2-[(3-nitrophenyl)methylamino]-2-oxoethyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 58965072 |
| Molecular Formula | C38H43N5O9 |
| Molecular Weight | 713.79 g/mol |
| Exact Mass | 713.31 |
| IUPAC Name | 4-[4-[1-[[1-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]isoquinolin-6-yl]amino]-2-[(3-nitrophenyl)methylamino]-2-oxoethyl]phenyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1nccc2cc(NC(C(=O)NCc3cccc([N+](=O)[O-])c3)c3ccc(CCCC(=O)O)cc3)ccc12 |
| InChI | InChI=1S/C38H43N5O9/c1-37(2,3)51-35(47)42(36(48)52-38(4,5)6)33-30-18-17-28(22-27(30)19-20-39-33)41-32(26-15-13-24(14-16-26)9-8-12-31(44)45)34(46)40-23-25-10-7-11-29(21-25)43(49)50/h7,10-11,13-22,32,41H,8-9,12,23H2,1-6H3,(H,40,46)(H,44,45) |
| InChIKey | RCLNGUUZCHHZSJ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 190.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.79 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|