C45H51N5O8 — CID 87587341
benzyl 5-[4-[1-[[1-[(2-methylpropan-2-yl)oxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]isoquinolin-6-yl]amino]-2-[(3-nitrophenyl)methylamino]-2-oxoethyl]phenyl]pentanoate (PubChem CID 87587341) has the molecular formula C45H51N5O8 and a molecular weight of 789.93 g/mol. Its IUPAC name is benzyl 5-[4-[1-[[1-[(2-methylpropan-2-yl)oxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]isoquinolin-6-yl]amino]-2-[(3-nitrophenyl)methylamino]-2-oxoethyl]phenyl]pentanoate.
| Compound Name | benzyl 5-[4-[1-[[1-[(2-methylpropan-2-yl)oxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]isoquinolin-6-yl]amino]-2-[(3-nitrophenyl)methylamino]-2-oxoethyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 87587341 |
| Molecular Formula | C45H51N5O8 |
| Molecular Weight | 789.93 g/mol |
| Exact Mass | 789.37 |
| IUPAC Name | benzyl 5-[4-[1-[[1-[(2-methylpropan-2-yl)oxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]isoquinolin-6-yl]amino]-2-[(3-nitrophenyl)methylamino]-2-oxoethyl]phenyl]pentanoate |
| SMILES | CC(C)(C)OC(=O)N(OC(C)(C)C)c1nccc2cc(NC(C(=O)NCc3cccc([N+](=O)[O-])c3)c3ccc(CCCCC(=O)OCc4ccccc4)cc3)ccc12 |
| InChI | InChI=1S/C45H51N5O8/c1-44(2,3)57-43(53)49(58-45(4,5)6)41-38-24-23-36(28-35(38)25-26-46-41)48-40(42(52)47-29-33-16-12-17-37(27-33)50(54)55)34-21-19-31(20-22-34)13-10-11-18-39(51)56-30-32-14-8-7-9-15-32/h7-9,12,14-17,19-28,40,48H,10-11,13,18,29-30H2,1-6H3,(H,47,52) |
| InChIKey | QZEOJSFVYRPZSC-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 162.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.93 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|