C22H21F3N4O4S — CID 58966336
5-[2-[4-butoxy-N-carbamoyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-hydroxybenzamide (PubChem CID 58966336) has the molecular formula C22H21F3N4O4S and a molecular weight of 494.50 g/mol. Its IUPAC name is 5-[2-[4-butoxy-N-carbamoyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-hydroxybenzamide.
| Compound Name | 5-[2-[4-butoxy-N-carbamoyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 58966336 |
| Molecular Formula | C22H21F3N4O4S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 5-[2-[4-butoxy-N-carbamoyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-hydroxybenzamide |
| SMILES | CCCCOc1ccc(N(C(N)=O)c2nc(-c3ccc(O)c(C(N)=O)c3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H21F3N4O4S/c1-2-3-8-33-18-7-5-13(10-15(18)22(23,24)25)29(20(27)32)21-28-16(11-34-21)12-4-6-17(30)14(9-12)19(26)31/h4-7,9-11,30H,2-3,8H2,1H3,(H2,26,31)(H2,27,32) |
| InChIKey | IYLQDBSUKVOFSC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|