C26H31BBrClN6O3 — CID 58967247
[(3R)-4-[(2R)-6-bromo-13-chloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-3-(3-imidazol-1-ylpropylcarbamoyl)piperazin-1-yl]-methylborinic acid (PubChem CID 58967247) has the molecular formula C26H31BBrClN6O3 and a molecular weight of 601.74 g/mol. Its IUPAC name is [(3R)-4-[(2R)-6-bromo-13-chloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-3-(3-imidazol-1-ylpropylcarbamoyl)piperazin-1-yl]-methylborinic acid.
| Compound Name | [(3R)-4-[(2R)-6-bromo-13-chloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-3-(3-imidazol-1-ylpropylcarbamoyl)piperazin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 58967247 |
| Molecular Formula | C26H31BBrClN6O3 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | [(3R)-4-[(2R)-6-bromo-13-chloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-3-(3-imidazol-1-ylpropylcarbamoyl)piperazin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCN([C@@H]2c3ccc(Cl)cc3CCc3cc(Br)c[n+]([O-])c32)[C@@H](C(=O)NCCCn2ccnc2)C1 |
| InChI | InChI=1S/C26H31BBrClN6O3/c1-27(37)33-11-12-34(23(16-33)26(36)31-7-2-9-32-10-8-30-17-32)25-22-6-5-21(29)14-18(22)3-4-19-13-20(28)15-35(38)24(19)25/h5-6,8,10,13-15,17,23,25,37H,2-4,7,9,11-12,16H2,1H3,(H,31,36)/t23-,25-/m1/s1 |
| InChIKey | KORGNLQDJBWXOU-ILBGXUMGSA-N |
| XLogP | 2.42 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|