C31H35FN4O2 — CID 58967931
1-[3-[(1-benzylpyrrolidin-3-yl)amino]propyl]-N-[(3-fluorophenyl)methyl]-7-methoxyindole-3-carboxamide (PubChem CID 58967931) has the molecular formula C31H35FN4O2 and a molecular weight of 514.65 g/mol. Its IUPAC name is 1-[3-[(1-benzylpyrrolidin-3-yl)amino]propyl]-N-[(3-fluorophenyl)methyl]-7-methoxyindole-3-carboxamide.
| Compound Name | 1-[3-[(1-benzylpyrrolidin-3-yl)amino]propyl]-N-[(3-fluorophenyl)methyl]-7-methoxyindole-3-carboxamide |
|---|---|
| PubChem CID | 58967931 |
| Molecular Formula | C31H35FN4O2 |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 1-[3-[(1-benzylpyrrolidin-3-yl)amino]propyl]-N-[(3-fluorophenyl)methyl]-7-methoxyindole-3-carboxamide |
| SMILES | COc1cccc2c(C(=O)NCc3cccc(F)c3)cn(CCCNC3CCN(Cc4ccccc4)C3)c12 |
| InChI | InChI=1S/C31H35FN4O2/c1-38-29-13-6-12-27-28(31(37)34-19-24-10-5-11-25(32)18-24)22-36(30(27)29)16-7-15-33-26-14-17-35(21-26)20-23-8-3-2-4-9-23/h2-6,8-13,18,22,26,33H,7,14-17,19-21H2,1H3,(H,34,37) |
| InChIKey | CCVADKJEMLRBLY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|