C17H24N6O14P2-2 — CID 58971937
[[(2R,3R)-4-acetamido-3,5-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 58971937) has the molecular formula C17H24N6O14P2-2 and a molecular weight of 598.36 g/mol. Its IUPAC name is [[(2R,3R)-4-acetamido-3,5-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | [[(2R,3R)-4-acetamido-3,5-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 58971937 |
| Molecular Formula | C17H24N6O14P2-2 |
| Molecular Weight | 598.36 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | [[(2R,3R)-4-acetamido-3,5-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | CC(=O)NC1C(O)O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@@H]2O[C@H](n3cnc4c(N)ncnc43)C(O)C2O)[C@@H]1O |
| InChI | InChI=1S/C17H26N6O14P2/c1-6(24)22-9-11(25)7(36-17(9)28)2-33-38(29,30)37-39(31,32)34-3-8-12(26)13(27)16(35-8)23-5-21-10-14(18)19-4-20-15(10)23/h4-5,7-9,11-13,16-17,25-28H,2-3H2,1H3,(H,22,24)(H,29,30)(H,31,32)(H2,18,19,20)/p-2/t7-,8+,9?,11+,12?,13?,16+,17?/m1/s1 |
| InChIKey | YKUBGMLROVEQHG-LZODLWPUSA-L |
| XLogP | -4.40 |
| TPSA | 306.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.36 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|